C26H38F3N3O4 — CID 11203065
(2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide (PubChem CID 11203065) has the molecular formula C26H38F3N3O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide.
| Compound Name | (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 11203065 |
| Molecular Formula | C26H38F3N3O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2R)-2-(2-cyclopentylethyl)-4-morpholin-4-yl-4-oxo-N-[(2S)-1-[4-(trifluoromethoxy)anilino]butan-2-yl]butanamide |
| SMILES | CC[C@@H](CNc1ccc(OC(F)(F)F)cc1)NC(=O)[C@H](CCC1CCCC1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H38F3N3O4/c1-2-21(18-30-22-9-11-23(12-10-22)36-26(27,28)29)31-25(34)20(8-7-19-5-3-4-6-19)17-24(33)32-13-15-35-16-14-32/h9-12,19-21,30H,2-8,13-18H2,1H3,(H,31,34)/t20-,21+/m1/s1 |
| InChIKey | IHERMNMIMQKETC-RTWAWAEBSA-N |
| XLogP | 4.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|