C29H30F3N3O4 — CID 69098527
(2S)-4-morpholin-4-yl-4-oxo-2-phenyl-N-[1-phenyl-2-[4-(trifluoromethoxy)anilino]ethyl]butanamide (PubChem CID 69098527) has the molecular formula C29H30F3N3O4 and a molecular weight of 541.57 g/mol. Its IUPAC name is (2S)-4-morpholin-4-yl-4-oxo-2-phenyl-N-[1-phenyl-2-[4-(trifluoromethoxy)anilino]ethyl]butanamide.
| Compound Name | (2S)-4-morpholin-4-yl-4-oxo-2-phenyl-N-[1-phenyl-2-[4-(trifluoromethoxy)anilino]ethyl]butanamide |
|---|---|
| PubChem CID | 69098527 |
| Molecular Formula | C29H30F3N3O4 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (2S)-4-morpholin-4-yl-4-oxo-2-phenyl-N-[1-phenyl-2-[4-(trifluoromethoxy)anilino]ethyl]butanamide |
| SMILES | O=C(NC(CNc1ccc(OC(F)(F)F)cc1)c1ccccc1)C(CC(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C29H30F3N3O4/c30-29(31,32)39-24-13-11-23(12-14-24)33-20-26(22-9-5-2-6-10-22)34-28(37)25(21-7-3-1-4-8-21)19-27(36)35-15-17-38-18-16-35/h1-14,25-26,33H,15-20H2,(H,34,37) |
| InChIKey | PSBWTPWDDHNYPT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|