C22H32F3N3O4 — CID 11271114
(2R)-4,4-dimethyl-2-(morpholine-4-carbonyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]propan-2-yl]pentanamide (PubChem CID 11271114) has the molecular formula C22H32F3N3O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-(morpholine-4-carbonyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]propan-2-yl]pentanamide.
| Compound Name | (2R)-4,4-dimethyl-2-(morpholine-4-carbonyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 11271114 |
| Molecular Formula | C22H32F3N3O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (2R)-4,4-dimethyl-2-(morpholine-4-carbonyl)-N-[(2S)-1-[4-(trifluoromethoxy)anilino]propan-2-yl]pentanamide |
| SMILES | C[C@@H](CNc1ccc(OC(F)(F)F)cc1)NC(=O)[C@@H](CC(C)(C)C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H32F3N3O4/c1-15(14-26-16-5-7-17(8-6-16)32-22(23,24)25)27-19(29)18(13-21(2,3)4)20(30)28-9-11-31-12-10-28/h5-8,15,18,26H,9-14H2,1-4H3,(H,27,29)/t15-,18+/m0/s1 |
| InChIKey | VGAFMMXVKRPACT-MAUKXSAKSA-N |
| XLogP | 3.41 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|