C23H32F3N3O5 — CID 90832619
[(3S)-oxolan-3-yl] N-[(2S)-3-cyclopentyl-1-oxo-1-[1-[4-(trifluoromethoxy)anilino]propan-2-ylamino]propan-2-yl]carbamate (PubChem CID 90832619) has the molecular formula C23H32F3N3O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(2S)-3-cyclopentyl-1-oxo-1-[1-[4-(trifluoromethoxy)anilino]propan-2-ylamino]propan-2-yl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(2S)-3-cyclopentyl-1-oxo-1-[1-[4-(trifluoromethoxy)anilino]propan-2-ylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90832619 |
| Molecular Formula | C23H32F3N3O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(2S)-3-cyclopentyl-1-oxo-1-[1-[4-(trifluoromethoxy)anilino]propan-2-ylamino]propan-2-yl]carbamate |
| SMILES | CC(CNc1ccc(OC(F)(F)F)cc1)NC(=O)[C@H](CC1CCCC1)NC(=O)O[C@H]1CCOC1 |
| InChI | InChI=1S/C23H32F3N3O5/c1-15(13-27-17-6-8-18(9-7-17)34-23(24,25)26)28-21(30)20(12-16-4-2-3-5-16)29-22(31)33-19-10-11-32-14-19/h6-9,15-16,19-20,27H,2-5,10-14H2,1H3,(H,28,30)(H,29,31)/t15?,19-,20-/m0/s1 |
| InChIKey | HCAQITULORTKDP-FIRGRZAASA-N |
| XLogP | 3.97 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|