C28H31F3N4O3S — CID 11478528
N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 11478528) has the molecular formula C28H31F3N4O3S and a molecular weight of 560.64 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11478528 |
| Molecular Formula | C28H31F3N4O3S |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)NCCNc1ccc(OC(F)(F)F)cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H31F3N4O3S/c29-28(30,31)38-22-13-11-21(12-14-22)32-15-16-33-25(36)23(17-19-7-3-1-4-8-19)34-26(37)24-18-39-27(35-24)20-9-5-2-6-10-20/h2,5-6,9-14,18-19,23,32H,1,3-4,7-8,15-17H2,(H,33,36)(H,34,37)/t23-/m0/s1 |
| InChIKey | NZWTXZRSTBMSNZ-QHCPKHFHSA-N |
| XLogP | 6.01 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|