C31H37N3O3 — CID 74078104
N-[3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-3-phenylbenzamide (PubChem CID 74078104) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-3-phenylbenzamide.
| Compound Name | N-[3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 74078104 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | N-[3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-3-phenylbenzamide |
| SMILES | COc1ccc(NCCNC(=O)C(CC2CCCCC2)NC(=O)c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-37-28-17-15-27(16-18-28)32-19-20-33-31(36)29(21-23-9-4-2-5-10-23)34-30(35)26-14-8-13-25(22-26)24-11-6-3-7-12-24/h3,6-8,11-18,22-23,29,32H,2,4-5,9-10,19-21H2,1H3,(H,33,36)(H,34,35) |
| InChIKey | ABTDLPNGXRILGJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|