C29H41N3O3 — CID 11408999
(2S)-4-cyclohexyl-N-[2-(4-methoxyanilino)ethyl]-2-[[(2R)-2-phenylbutanoyl]amino]butanamide (PubChem CID 11408999) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is (2S)-4-cyclohexyl-N-[2-(4-methoxyanilino)ethyl]-2-[[(2R)-2-phenylbutanoyl]amino]butanamide.
| Compound Name | (2S)-4-cyclohexyl-N-[2-(4-methoxyanilino)ethyl]-2-[[(2R)-2-phenylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 11408999 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | (2S)-4-cyclohexyl-N-[2-(4-methoxyanilino)ethyl]-2-[[(2R)-2-phenylbutanoyl]amino]butanamide |
| SMILES | CCC(C(=O)N[C@@H](CCC1CCCCC1)C(=O)NCCNc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H41N3O3/c1-3-26(23-12-8-5-9-13-23)28(33)32-27(19-14-22-10-6-4-7-11-22)29(34)31-21-20-30-24-15-17-25(35-2)18-16-24/h5,8-9,12-13,15-18,22,26-27,30H,3-4,6-7,10-11,14,19-21H2,1-2H3,(H,31,34)(H,32,33)/t26?,27-/m0/s1 |
| InChIKey | FFGFAKXCDRIVLI-GEVKEYJPSA-N |
| XLogP | 5.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|