C31H37N3O4 — CID 23648337
N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-phenoxybenzamide (PubChem CID 23648337) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-phenoxybenzamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 23648337 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-phenoxybenzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O4/c1-37-26-18-14-25(15-19-26)32-20-21-33-31(36)29(22-23-8-4-2-5-9-23)34-30(35)24-12-16-28(17-13-24)38-27-10-6-3-7-11-27/h3,6-7,10-19,23,29,32H,2,4-5,8-9,20-22H2,1H3,(H,33,36)(H,34,35)/t29-/m0/s1 |
| InChIKey | FNHJCRXTPKRSGT-LJAQVGFWSA-N |
| XLogP | 5.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|