C29H36ClN5O3 — CID 91498963
1-(4-chlorophenyl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methylpyrazole-4-carboxamide (PubChem CID 91498963) has the molecular formula C29H36ClN5O3 and a molecular weight of 538.09 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91498963 |
| Molecular Formula | C29H36ClN5O3 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-5-methylpyrazole-4-carboxamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2cnn(-c3ccc(Cl)cc3)c2C)cc1 |
| InChI | InChI=1S/C29H36ClN5O3/c1-20-26(19-33-35(20)24-12-8-22(30)9-13-24)28(36)34-27(18-21-6-4-3-5-7-21)29(37)32-17-16-31-23-10-14-25(38-2)15-11-23/h8-15,19,21,27,31H,3-7,16-18H2,1-2H3,(H,32,37)(H,34,36)/t27-/m0/s1 |
| InChIKey | OIIAPQVZRYLBRD-MHZLTWQESA-N |
| XLogP | 5.14 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|