C22H30N4O2 — CID 100905771
N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-methoxyphenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 100905771) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-methoxyphenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-methoxyphenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 100905771 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-methoxyphenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)NC[C@H]3CCCN4CCCC[C@@H]34)c2C)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-16-20(15-24-26(16)18-8-10-19(28-2)11-9-18)22(27)23-14-17-6-5-13-25-12-4-3-7-21(17)25/h8-11,15,17,21H,3-7,12-14H2,1-2H3,(H,23,27)/t17-,21+/m1/s1 |
| InChIKey | VFDCJOLMWUQVJV-UTKZUKDTSA-N |
| XLogP | 3.18 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |