C32H36F3N3O4 — CID 11180766
N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(3-methoxyphenyl)benzamide (PubChem CID 11180766) has the molecular formula C32H36F3N3O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 11180766 |
| Molecular Formula | C32H36F3N3O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cccc(C(=O)N[C@@H](CC3CCCCC3)C(=O)NCCNc3ccc(OC(F)(F)F)cc3)c2)c1 |
| InChI | InChI=1S/C32H36F3N3O4/c1-41-28-12-6-10-24(21-28)23-9-5-11-25(20-23)30(39)38-29(19-22-7-3-2-4-8-22)31(40)37-18-17-36-26-13-15-27(16-14-26)42-32(33,34)35/h5-6,9-16,20-22,29,36H,2-4,7-8,17-19H2,1H3,(H,37,40)(H,38,39)/t29-/m0/s1 |
| InChIKey | ZPJWRHLVWJXAMJ-LJAQVGFWSA-N |
| XLogP | 6.56 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|