C31H36F3N5O6 — CID 21055492
N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide (PubChem CID 21055492) has the molecular formula C31H36F3N5O6 and a molecular weight of 631.65 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 21055492 |
| Molecular Formula | C31H36F3N5O6 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-oxo-1-[2-[4-(trifluoromethoxy)anilino]ethylamino]propan-2-yl]-3-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
| SMILES | COc1cc(OC)nc(Oc2cccc(C(=O)N[C@@H](CC3CCCCC3)C(=O)NCCNc3ccc(OC(F)(F)F)cc3)c2)n1 |
| InChI | InChI=1S/C31H36F3N5O6/c1-42-26-19-27(43-2)39-30(38-26)44-24-10-6-9-21(18-24)28(40)37-25(17-20-7-4-3-5-8-20)29(41)36-16-15-35-22-11-13-23(14-12-22)45-31(32,33)34/h6,9-14,18-20,25,35H,3-5,7-8,15-17H2,1-2H3,(H,36,41)(H,37,40)/t25-/m0/s1 |
| InChIKey | LMZPNOJFBNFTIS-VWLOTQADSA-N |
| XLogP | 5.48 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|