C26H34BrN3O3 — CID 11168269
3-bromo-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-methylbenzamide (PubChem CID 11168269) has the molecular formula C26H34BrN3O3 and a molecular weight of 516.48 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11168269 |
| Molecular Formula | C26H34BrN3O3 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-bromo-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]-4-methylbenzamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C26H34BrN3O3/c1-18-8-9-20(17-23(18)27)25(31)30-24(16-19-6-4-3-5-7-19)26(32)29-15-14-28-21-10-12-22(33-2)13-11-21/h8-13,17,19,24,28H,3-7,14-16H2,1-2H3,(H,29,32)(H,30,31)/t24-/m0/s1 |
| InChIKey | BWQWPNIPNNQZSX-DEOSSOPVSA-N |
| XLogP | 5.06 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|