C18H29N3O2 — CID 69195150
(2S)-2-amino-3-cyclohexyl-N-[(2S)-1-(4-hydroxyanilino)propan-2-yl]propanamide (PubChem CID 69195150) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexyl-N-[(2S)-1-(4-hydroxyanilino)propan-2-yl]propanamide.
| Compound Name | (2S)-2-amino-3-cyclohexyl-N-[(2S)-1-(4-hydroxyanilino)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 69195150 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2S)-2-amino-3-cyclohexyl-N-[(2S)-1-(4-hydroxyanilino)propan-2-yl]propanamide |
| SMILES | C[C@@H](CNc1ccc(O)cc1)NC(=O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C18H29N3O2/c1-13(12-20-15-7-9-16(22)10-8-15)21-18(23)17(19)11-14-5-3-2-4-6-14/h7-10,13-14,17,20,22H,2-6,11-12,19H2,1H3,(H,21,23)/t13-,17-/m0/s1 |
| InChIKey | UYIZTWSUGYDZGS-GUYCJALGSA-N |
| XLogP | 2.61 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|