C8H17N3O — CID 116849612
2-amino-3-cyclobutyl-N'-methylpropanehydrazide (PubChem CID 116849612) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-amino-3-cyclobutyl-N'-methylpropanehydrazide.
| Compound Name | 2-amino-3-cyclobutyl-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 116849612 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-amino-3-cyclobutyl-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)C(N)CC1CCC1 |
| InChI | InChI=1S/C8H17N3O/c1-10-11-8(12)7(9)5-6-3-2-4-6/h6-7,10H,2-5,9H2,1H3,(H,11,12) |
| InChIKey | XCDVJEXPXZCFFN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|