C23H31N2O4P — CID 11080507
(2S)-2-amino-3-cyclohexyl-N-(1-diphenoxyphosphorylethyl)propanamide (PubChem CID 11080507) has the molecular formula C23H31N2O4P and a molecular weight of 430.49 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexyl-N-(1-diphenoxyphosphorylethyl)propanamide.
| Compound Name | (2S)-2-amino-3-cyclohexyl-N-(1-diphenoxyphosphorylethyl)propanamide |
|---|---|
| PubChem CID | 11080507 |
| Molecular Formula | C23H31N2O4P |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2S)-2-amino-3-cyclohexyl-N-(1-diphenoxyphosphorylethyl)propanamide |
| SMILES | CC(NC(=O)[C@@H](N)CC1CCCCC1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N2O4P/c1-18(25-23(26)22(24)17-19-11-5-2-6-12-19)30(27,28-20-13-7-3-8-14-20)29-21-15-9-4-10-16-21/h3-4,7-10,13-16,18-19,22H,2,5-6,11-12,17,24H2,1H3,(H,25,26)/t18?,22-/m0/s1 |
| InChIKey | HVIYSVPMUJEINS-YSYXNDDBSA-N |
| XLogP | 5.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|