C24H38N4O4S — CID 89041309
N-[(2S)-3-cyclohexyl-1-[[(2S)-1-(4-hydroxyanilino)-4-sulfanylbutan-2-yl]amino]-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 89041309) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[[(2S)-1-(4-hydroxyanilino)-4-sulfanylbutan-2-yl]amino]-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[[(2S)-1-(4-hydroxyanilino)-4-sulfanylbutan-2-yl]amino]-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 89041309 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[[(2S)-1-(4-hydroxyanilino)-4-sulfanylbutan-2-yl]amino]-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@@H](CCS)CNc1ccc(O)cc1)[C@H](CC1CCCCC1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H38N4O4S/c29-21-8-6-19(7-9-21)25-17-20(10-15-33)26-23(30)22(16-18-4-2-1-3-5-18)27-24(31)28-11-13-32-14-12-28/h6-9,18,20,22,25,29,33H,1-5,10-17H2,(H,26,30)(H,27,31)/t20-,22-/m0/s1 |
| InChIKey | PETNKQRQCUVSGM-UNMCSNQZSA-N |
| XLogP | 2.99 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|