C26H41N5O3S — CID 23627196
N-[(2S)-1-[[(3S)-3-[(S)-amino(sulfanyl)methyl]-1-benzylpyrrolidin-3-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 23627196) has the molecular formula C26H41N5O3S and a molecular weight of 503.71 g/mol. Its IUPAC name is N-[(2S)-1-[[(3S)-3-[(S)-amino(sulfanyl)methyl]-1-benzylpyrrolidin-3-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[(3S)-3-[(S)-amino(sulfanyl)methyl]-1-benzylpyrrolidin-3-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 23627196 |
| Molecular Formula | C26H41N5O3S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | N-[(2S)-1-[[(3S)-3-[(S)-amino(sulfanyl)methyl]-1-benzylpyrrolidin-3-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | N[C@@H](S)[C@]1(NC(=O)[C@H](CC2CCCCC2)NC(=O)N2CCOCC2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H41N5O3S/c27-24(35)26(11-12-30(19-26)18-21-9-5-2-6-10-21)29-23(32)22(17-20-7-3-1-4-8-20)28-25(33)31-13-15-34-16-14-31/h2,5-6,9-10,20,22,24,35H,1,3-4,7-8,11-19,27H2,(H,28,33)(H,29,32)/t22-,24-,26-/m0/s1 |
| InChIKey | SYYPOPSZUGMAIG-GVUKDKGQSA-N |
| XLogP | 2.34 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|