C17H31N3O3 — CID 59414130
N-[(2S)-3-cycloheptyl-1-(ethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 59414130) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-[(2S)-3-cycloheptyl-1-(ethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-3-cycloheptyl-1-(ethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 59414130 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N-[(2S)-3-cycloheptyl-1-(ethylamino)-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | CCNC(=O)[C@H](CC1CCCCCC1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H31N3O3/c1-2-18-16(21)15(13-14-7-5-3-4-6-8-14)19-17(22)20-9-11-23-12-10-20/h14-15H,2-13H2,1H3,(H,18,21)(H,19,22)/t15-/m0/s1 |
| InChIKey | JJNOTAPJJVMLKK-HNNXBMFYSA-N |
| XLogP | 1.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |