C25H37N5O2 — CID 141163058
N-(1-benzyl-3-cyanopyrrolidin-3-yl)-3-cyclohexyl-2-(morpholin-2-ylamino)propanamide (PubChem CID 141163058) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-(1-benzyl-3-cyanopyrrolidin-3-yl)-3-cyclohexyl-2-(morpholin-2-ylamino)propanamide.
| Compound Name | N-(1-benzyl-3-cyanopyrrolidin-3-yl)-3-cyclohexyl-2-(morpholin-2-ylamino)propanamide |
|---|---|
| PubChem CID | 141163058 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-(1-benzyl-3-cyanopyrrolidin-3-yl)-3-cyclohexyl-2-(morpholin-2-ylamino)propanamide |
| SMILES | N#CC1(NC(=O)C(CC2CCCCC2)NC2CNCCO2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H37N5O2/c26-18-25(11-13-30(19-25)17-21-9-5-2-6-10-21)29-24(31)22(15-20-7-3-1-4-8-20)28-23-16-27-12-14-32-23/h2,5-6,9-10,20,22-23,27-28H,1,3-4,7-8,11-17,19H2,(H,29,31) |
| InChIKey | PJGVNVHVYWPSSF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |