C27H34N4O2 — CID 69416465
2-amino-N-[3-cyano-1-[(2-phenoxyphenyl)methyl]pyrrolidin-3-yl]-3-cyclohexylpropanamide (PubChem CID 69416465) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 2-amino-N-[3-cyano-1-[(2-phenoxyphenyl)methyl]pyrrolidin-3-yl]-3-cyclohexylpropanamide.
| Compound Name | 2-amino-N-[3-cyano-1-[(2-phenoxyphenyl)methyl]pyrrolidin-3-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 69416465 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-amino-N-[3-cyano-1-[(2-phenoxyphenyl)methyl]pyrrolidin-3-yl]-3-cyclohexylpropanamide |
| SMILES | N#CC1(NC(=O)C(N)CC2CCCCC2)CCN(Cc2ccccc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C27H34N4O2/c28-19-27(30-26(32)24(29)17-21-9-3-1-4-10-21)15-16-31(20-27)18-22-11-7-8-14-25(22)33-23-12-5-2-6-13-23/h2,5-8,11-14,21,24H,1,3-4,9-10,15-18,20,29H2,(H,30,32) |
| InChIKey | JNAXPUKICLDXAV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |