C13H15F5N2O — CID 141417016
2,3-difluoro-2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]pentanamide (PubChem CID 141417016) has the molecular formula C13H15F5N2O and a molecular weight of 310.27 g/mol. Its IUPAC name is 2,3-difluoro-2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]pentanamide.
| Compound Name | 2,3-difluoro-2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]pentanamide |
|---|---|
| PubChem CID | 141417016 |
| Molecular Formula | C13H15F5N2O |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2,3-difluoro-2-[[(1S)-2,2,2-trifluoro-1-phenylethyl]amino]pentanamide |
| SMILES | CCC(F)C(F)(N[C@@H](c1ccccc1)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C13H15F5N2O/c1-2-9(14)12(15,11(19)21)20-10(13(16,17)18)8-6-4-3-5-7-8/h3-7,9-10,20H,2H2,1H3,(H2,19,21)/t9?,10-,12?/m0/s1 |
| InChIKey | VULKPLDASZNYAL-YZRBJQDESA-N |
| XLogP | 2.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|