C20H32N2O3 — CID 46193688
benzyl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate (PubChem CID 46193688) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 46193688 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)[C@H](C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H32N2O3/c1-14(2)12-17(21-5)19(23)22(6)18(15(3)4)20(24)25-13-16-10-8-7-9-11-16/h7-11,14-15,17-18,21H,12-13H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | XUBMRNUDCONYOL-ROUUACIJSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |