C32H40N2O3 — CID 175928138
trityl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate (PubChem CID 175928138) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is trityl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate.
| Compound Name | trityl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 175928138 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | trityl (2S)-3-methyl-2-[methyl-[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)[C@H](C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C32H40N2O3/c1-23(2)22-28(33-5)30(35)34(6)29(24(3)4)31(36)37-32(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,23-24,28-29,33H,22H2,1-6H3/t28-,29-/m0/s1 |
| InChIKey | WPZUXSNEQHNZFC-VMPREFPWSA-N |
| XLogP | 5.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|