C36H47N3O4 — CID 175928171
trityl 2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]amino]-2-methylpropanoate (PubChem CID 175928171) has the molecular formula C36H47N3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is trityl 2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]amino]-2-methylpropanoate.
| Compound Name | trityl 2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 175928171 |
| Molecular Formula | C36H47N3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | trityl 2-[[(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]amino]-2-methylpropanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N(C)[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H47N3O4/c1-8-26(4)31(37)33(41)39(7)30(24-25(2)3)32(40)38-35(5,6)34(42)43-36(27-18-12-9-13-19-27,28-20-14-10-15-21-28)29-22-16-11-17-23-29/h9-23,25-26,30-31H,8,24,37H2,1-7H3,(H,38,40)/t26-,30-,31-/m0/s1 |
| InChIKey | HNGNIVPPJYSBPA-JOYXZSCHSA-N |
| XLogP | 5.66 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|