C6H14ClNO5P+ — CID 87321067
2-(chloroamino)-4-methylpentanoic acid;dihydroxy(oxo)phosphanium (PubChem CID 87321067) has the molecular formula C6H14ClNO5P+ and a molecular weight of 246.61 g/mol. Its IUPAC name is 2-(chloroamino)-4-methylpentanoic acid;dihydroxy(oxo)phosphanium.
| Compound Name | 2-(chloroamino)-4-methylpentanoic acid;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 87321067 |
| Molecular Formula | C6H14ClNO5P+ |
| Molecular Weight | 246.61 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(chloroamino)-4-methylpentanoic acid;dihydroxy(oxo)phosphanium |
| SMILES | CC(C)CC(NCl)C(=O)O.O=[P+](O)O |
| InChI | InChI=1S/C6H12ClNO2.HO3P/c1-4(2)3-5(8-7)6(9)10;1-4(2)3/h4-5,8H,3H2,1-2H3,(H,9,10);(H-,1,2,3)/p+1 |
| InChIKey | DTYWBZNXSRMLPR-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|