2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid

C9H17F2NO2 — CID 102869392

IUPAC2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid
SMILESCC(C)CC(NC(C)C(F)F)C(=O)O
InChIInChI=1S/C9H17F2NO2/c1-5(2)4-7(9(13)14)12-6(3)8(10)11/h5-8,12H,4H2,1-3H3,(H,13,14)
InChIKeyNLMXYAPVVMXGNI-UHFFFAOYSA-N
MW209.24 g/mol
LogP1.73
Rot. Bonds6

About 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid

2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid (PubChem CID 102869392) has the molecular formula C9H17F2NO2 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid
PubChem CID102869392
Molecular FormulaC9H17F2NO2
Molecular Weight209.24 g/mol
Exact Mass209.12
IUPAC Name2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid
SMILESCC(C)CC(NC(C)C(F)F)C(=O)O
InChIInChI=1S/C9H17F2NO2/c1-5(2)4-7(9(13)14)12-6(3)8(10)11/h5-8,12H,4H2,1-3H3,(H,13,14)
InChIKeyNLMXYAPVVMXGNI-UHFFFAOYSA-N
XLogP1.73
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.24
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid?
The IUPAC name of 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid (CID 102869392) is 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid.
What is the SMILES notation for 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid?
The canonical SMILES for 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid is CC(C)CC(NC(C)C(F)F)C(=O)O.
What is the InChIKey of 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid?
The InChIKey is NLMXYAPVVMXGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2/c1-5(2)4-7(9(13)14)12-6(3)8(10)11/h5-8,12H,4H2,1-3H3,(H,13,14).
What are the key properties of 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid?
2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid has a molecular weight of 209.24 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoropropan-2-ylamino)-4-methylpentanoic acid is sourced from PubChem (CID 102869392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).