C8H18NO5P — CID 89334086
[(1R)-1-amino-3-methylbutyl]-(2-methylperoxy-2-oxoethyl)phosphinic acid (PubChem CID 89334086) has the molecular formula C8H18NO5P and a molecular weight of 239.21 g/mol. Its IUPAC name is [(1R)-1-amino-3-methylbutyl]-(2-methylperoxy-2-oxoethyl)phosphinic acid.
| Compound Name | [(1R)-1-amino-3-methylbutyl]-(2-methylperoxy-2-oxoethyl)phosphinic acid |
|---|---|
| PubChem CID | 89334086 |
| Molecular Formula | C8H18NO5P |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [(1R)-1-amino-3-methylbutyl]-(2-methylperoxy-2-oxoethyl)phosphinic acid |
| SMILES | COOC(=O)CP(=O)(O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C8H18NO5P/c1-6(2)4-7(9)15(11,12)5-8(10)14-13-3/h6-7H,4-5,9H2,1-3H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | NYITYVLJDXLSTD-SSDOTTSWSA-N |
| XLogP | 0.69 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|