C9H19N2O4P — CID 146037078
1-[[(2S)-2-amino-4-methylpentanoyl]amino]ethenyl-methoxyphosphinic acid (PubChem CID 146037078) has the molecular formula C9H19N2O4P and a molecular weight of 250.23 g/mol. Its IUPAC name is 1-[[(2S)-2-amino-4-methylpentanoyl]amino]ethenyl-methoxyphosphinic acid.
| Compound Name | 1-[[(2S)-2-amino-4-methylpentanoyl]amino]ethenyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 146037078 |
| Molecular Formula | C9H19N2O4P |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[[(2S)-2-amino-4-methylpentanoyl]amino]ethenyl-methoxyphosphinic acid |
| SMILES | C=C(NC(=O)[C@@H](N)CC(C)C)P(=O)(O)OC |
| InChI | InChI=1S/C9H19N2O4P/c1-6(2)5-8(10)9(12)11-7(3)16(13,14)15-4/h6,8H,3,5,10H2,1-2,4H3,(H,11,12)(H,13,14)/t8-/m0/s1 |
| InChIKey | IKHSJINCWSUCBW-QMMMGPOBSA-N |
| XLogP | 0.78 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|