C16H20NO4PS — CID 57189722
2-[[hydroxy(quinolin-2-ylsulfanylmethyl)phosphoryl]methyl]pentanoic acid (PubChem CID 57189722) has the molecular formula C16H20NO4PS and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[[hydroxy(quinolin-2-ylsulfanylmethyl)phosphoryl]methyl]pentanoic acid.
| Compound Name | 2-[[hydroxy(quinolin-2-ylsulfanylmethyl)phosphoryl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 57189722 |
| Molecular Formula | C16H20NO4PS |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[[hydroxy(quinolin-2-ylsulfanylmethyl)phosphoryl]methyl]pentanoic acid |
| SMILES | CCCC(CP(=O)(O)CSc1ccc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C16H20NO4PS/c1-2-5-13(16(18)19)10-22(20,21)11-23-15-9-8-12-6-3-4-7-14(12)17-15/h3-4,6-9,13H,2,5,10-11H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | DGDLMXVDRFUBOF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|