C17H20NO4PS — CID 57011385
2-[hydroxy(quinolin-2-ylsulfanyl)methyl]-4-methyl-6-phosphorosohexanoic acid (PubChem CID 57011385) has the molecular formula C17H20NO4PS and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[hydroxy(quinolin-2-ylsulfanyl)methyl]-4-methyl-6-phosphorosohexanoic acid.
| Compound Name | 2-[hydroxy(quinolin-2-ylsulfanyl)methyl]-4-methyl-6-phosphorosohexanoic acid |
|---|---|
| PubChem CID | 57011385 |
| Molecular Formula | C17H20NO4PS |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[hydroxy(quinolin-2-ylsulfanyl)methyl]-4-methyl-6-phosphorosohexanoic acid |
| SMILES | CC(CCP=O)CC(C(=O)O)C(O)Sc1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H20NO4PS/c1-11(8-9-23-22)10-13(16(19)20)17(21)24-15-7-6-12-4-2-3-5-14(12)18-15/h2-7,11,13,17,21H,8-10H2,1H3,(H,19,20) |
| InChIKey | AFZNIELZMJCPFK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|