C17H21NO4PS+ — CID 159200601
(3-carboxy-2-hydroxy-5-methyl-1-quinolin-2-ylsulfanylhexan-2-yl)-oxophosphanium (PubChem CID 159200601) has the molecular formula C17H21NO4PS+ and a molecular weight of 366.40 g/mol. Its IUPAC name is (3-carboxy-2-hydroxy-5-methyl-1-quinolin-2-ylsulfanylhexan-2-yl)-oxophosphanium.
| Compound Name | (3-carboxy-2-hydroxy-5-methyl-1-quinolin-2-ylsulfanylhexan-2-yl)-oxophosphanium |
|---|---|
| PubChem CID | 159200601 |
| Molecular Formula | C17H21NO4PS+ |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3-carboxy-2-hydroxy-5-methyl-1-quinolin-2-ylsulfanylhexan-2-yl)-oxophosphanium |
| SMILES | CC(C)CC(C(=O)O)C(O)(CSc1ccc2ccccc2n1)[PH+]=O |
| InChI | InChI=1S/C17H20NO4PS/c1-11(2)9-13(16(19)20)17(21,23-22)10-24-15-8-7-12-5-3-4-6-14(12)18-15/h3-8,11,13,21H,9-10H2,1-2H3,(H,19,20)/p+1 |
| InChIKey | KPFUIZWQOSSRQX-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|