C31H38N3O8PS+2 — CID 123743646
[1-[1-[(4-carboxybenzoyl)amino]quinolin-1-ium-2-yl]sulfanyl-3-[[(1S)-1-carboxy-3-methylbutyl]carbamoyl]-2-hydroxy-5-methylhexan-2-yl]-oxophosphanium (PubChem CID 123743646) has the molecular formula C31H38N3O8PS+2 and a molecular weight of 643.70 g/mol. Its IUPAC name is [1-[1-[(4-carboxybenzoyl)amino]quinolin-1-ium-2-yl]sulfanyl-3-[[(1S)-1-carboxy-3-methylbutyl]carbamoyl]-2-hydroxy-5-methylhexan-2-yl]-oxophosphanium.
| Compound Name | [1-[1-[(4-carboxybenzoyl)amino]quinolin-1-ium-2-yl]sulfanyl-3-[[(1S)-1-carboxy-3-methylbutyl]carbamoyl]-2-hydroxy-5-methylhexan-2-yl]-oxophosphanium |
|---|---|
| PubChem CID | 123743646 |
| Molecular Formula | C31H38N3O8PS+2 |
| Molecular Weight | 643.70 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | [1-[1-[(4-carboxybenzoyl)amino]quinolin-1-ium-2-yl]sulfanyl-3-[[(1S)-1-carboxy-3-methylbutyl]carbamoyl]-2-hydroxy-5-methylhexan-2-yl]-oxophosphanium |
| SMILES | CC(C)CC(C(=O)N[C@@H](CC(C)C)C(=O)O)C(O)(CSc1ccc2ccccc2[n+]1NC(=O)c1ccc(C(=O)O)cc1)[PH+]=O |
| InChI | InChI=1S/C31H36N3O8PS/c1-18(2)15-23(28(36)32-24(30(39)40)16-19(3)4)31(41,43-42)17-44-26-14-13-20-7-5-6-8-25(20)34(26)33-27(35)21-9-11-22(12-10-21)29(37)38/h5-14,18-19,23-24,41H,15-17H2,1-4H3,(H3-,32,33,35,36,37,38,39,40)/p+2/t23?,24-,31?/m0/s1 |
| InChIKey | PPHRMOMWJJWVHK-JIULZDTGSA-P |
| XLogP | 4.29 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|