C13H18O2S — CID 79228431
2-(2-phenylsulfanylethyl)pentanoic acid (PubChem CID 79228431) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)pentanoic acid.
| Compound Name | 2-(2-phenylsulfanylethyl)pentanoic acid |
|---|---|
| PubChem CID | 79228431 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)pentanoic acid |
| SMILES | CCCC(CCSc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18O2S/c1-2-6-11(13(14)15)9-10-16-12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3,(H,14,15) |
| InChIKey | OMFFYYLNOWHIRV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |