C16H20NO3PS — CID 140982350
2-hydroxy-2-(quinolin-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid (PubChem CID 140982350) has the molecular formula C16H20NO3PS and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-hydroxy-2-(quinolin-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid.
| Compound Name | 2-hydroxy-2-(quinolin-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 140982350 |
| Molecular Formula | C16H20NO3PS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-hydroxy-2-(quinolin-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid |
| SMILES | CCCC(O)(CPCSc1ccc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C16H20NO3PS/c1-2-9-16(20,15(18)19)10-21-11-22-14-8-7-12-5-3-4-6-13(12)17-14/h3-8,20-21H,2,9-11H2,1H3,(H,18,19) |
| InChIKey | VRQAYDRZDWFLKF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|