C13H19O3PS — CID 140982289
2-hydroxy-2-(phenylsulfanylmethylphosphanylmethyl)pentanoic acid (PubChem CID 140982289) has the molecular formula C13H19O3PS and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-hydroxy-2-(phenylsulfanylmethylphosphanylmethyl)pentanoic acid.
| Compound Name | 2-hydroxy-2-(phenylsulfanylmethylphosphanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 140982289 |
| Molecular Formula | C13H19O3PS |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-hydroxy-2-(phenylsulfanylmethylphosphanylmethyl)pentanoic acid |
| SMILES | CCCC(O)(CPCSc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H19O3PS/c1-2-8-13(16,12(14)15)9-17-10-18-11-6-4-3-5-7-11/h3-7,16-17H,2,8-10H2,1H3,(H,14,15) |
| InChIKey | DGNNTLCZRNHLFF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|