C21H29O3PS — CID 140982335
ethyl 2-ethoxy-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoate (PubChem CID 140982335) has the molecular formula C21H29O3PS and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl 2-ethoxy-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoate.
| Compound Name | ethyl 2-ethoxy-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoate |
|---|---|
| PubChem CID | 140982335 |
| Molecular Formula | C21H29O3PS |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 2-ethoxy-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoate |
| SMILES | CCCC(CPCSc1ccc2ccccc2c1)(OCC)C(=O)OCC |
| InChI | InChI=1S/C21H29O3PS/c1-4-13-21(24-6-3,20(22)23-5-2)15-25-16-26-19-12-11-17-9-7-8-10-18(17)14-19/h7-12,14,25H,4-6,13,15-16H2,1-3H3 |
| InChIKey | DXZVIDCSQWCDOV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|