C18H23O3PS — CID 140982285
2-hydroxy-4-methyl-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid (PubChem CID 140982285) has the molecular formula C18H23O3PS and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid.
| Compound Name | 2-hydroxy-4-methyl-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 140982285 |
| Molecular Formula | C18H23O3PS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-hydroxy-4-methyl-2-(naphthalen-2-ylsulfanylmethylphosphanylmethyl)pentanoic acid |
| SMILES | CC(C)CC(O)(CPCSc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C18H23O3PS/c1-13(2)10-18(21,17(19)20)11-22-12-23-16-8-7-14-5-3-4-6-15(14)9-16/h3-9,13,21-22H,10-12H2,1-2H3,(H,19,20) |
| InChIKey | HJMNWCTWAIFFKK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|