C18H21O4PS — CID 154287678
2-hydroxy-4-methyl-3-(naphthalen-2-ylsulfanylmethyl)-2-(phosphorosomethyl)pentanoic acid (PubChem CID 154287678) has the molecular formula C18H21O4PS and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-3-(naphthalen-2-ylsulfanylmethyl)-2-(phosphorosomethyl)pentanoic acid.
| Compound Name | 2-hydroxy-4-methyl-3-(naphthalen-2-ylsulfanylmethyl)-2-(phosphorosomethyl)pentanoic acid |
|---|---|
| PubChem CID | 154287678 |
| Molecular Formula | C18H21O4PS |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-hydroxy-4-methyl-3-(naphthalen-2-ylsulfanylmethyl)-2-(phosphorosomethyl)pentanoic acid |
| SMILES | CC(C)C(CSc1ccc2ccccc2c1)C(O)(CP=O)C(=O)O |
| InChI | InChI=1S/C18H21O4PS/c1-12(2)16(18(21,11-23-22)17(19)20)10-24-15-8-7-13-5-3-4-6-14(13)9-15/h3-9,12,16,21H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | FSLLPLCTVTYIEL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|