C20H24NO4PS — CID 154223109
3-cyclohexyl-2-hydroxy-2-(phosphorosomethyl)-4-quinolin-2-ylsulfanylbutanoic acid (PubChem CID 154223109) has the molecular formula C20H24NO4PS and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-cyclohexyl-2-hydroxy-2-(phosphorosomethyl)-4-quinolin-2-ylsulfanylbutanoic acid.
| Compound Name | 3-cyclohexyl-2-hydroxy-2-(phosphorosomethyl)-4-quinolin-2-ylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 154223109 |
| Molecular Formula | C20H24NO4PS |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-cyclohexyl-2-hydroxy-2-(phosphorosomethyl)-4-quinolin-2-ylsulfanylbutanoic acid |
| SMILES | O=PCC(O)(C(=O)O)C(CSc1ccc2ccccc2n1)C1CCCCC1 |
| InChI | InChI=1S/C20H24NO4PS/c22-19(23)20(24,13-26-25)16(14-6-2-1-3-7-14)12-27-18-11-10-15-8-4-5-9-17(15)21-18/h4-5,8-11,14,16,24H,1-3,6-7,12-13H2,(H,22,23) |
| InChIKey | GCZVKHYJADENLJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|