C22H29NO3PS+ — CID 67764657
[2-(cyclohexylmethyl)-3-ethoxy-3-oxopropyl]-oxo-(quinolin-2-ylsulfanylmethyl)phosphanium (PubChem CID 67764657) has the molecular formula C22H29NO3PS+ and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-(cyclohexylmethyl)-3-ethoxy-3-oxopropyl]-oxo-(quinolin-2-ylsulfanylmethyl)phosphanium.
| Compound Name | [2-(cyclohexylmethyl)-3-ethoxy-3-oxopropyl]-oxo-(quinolin-2-ylsulfanylmethyl)phosphanium |
|---|---|
| PubChem CID | 67764657 |
| Molecular Formula | C22H29NO3PS+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-(cyclohexylmethyl)-3-ethoxy-3-oxopropyl]-oxo-(quinolin-2-ylsulfanylmethyl)phosphanium |
| SMILES | CCOC(=O)C(CC1CCCCC1)C[P+](=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H29NO3PS/c1-2-26-22(24)19(14-17-8-4-3-5-9-17)15-27(25)16-28-21-13-12-18-10-6-7-11-20(18)23-21/h6-7,10-13,17,19H,2-5,8-9,14-16H2,1H3/q+1 |
| InChIKey | CGSUQRMHOAAWMK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|