C21H28NO4PS — CID 140971613
(2-ethoxy-2-ethoxycarbonyl-4-methylpentylidene)-oxido-(quinolin-2-ylsulfanylmethyl)phosphanium (PubChem CID 140971613) has the molecular formula C21H28NO4PS and a molecular weight of 421.50 g/mol. Its IUPAC name is (2-ethoxy-2-ethoxycarbonyl-4-methylpentylidene)-oxido-(quinolin-2-ylsulfanylmethyl)phosphanium.
| Compound Name | (2-ethoxy-2-ethoxycarbonyl-4-methylpentylidene)-oxido-(quinolin-2-ylsulfanylmethyl)phosphanium |
|---|---|
| PubChem CID | 140971613 |
| Molecular Formula | C21H28NO4PS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (2-ethoxy-2-ethoxycarbonyl-4-methylpentylidene)-oxido-(quinolin-2-ylsulfanylmethyl)phosphanium |
| SMILES | CCOC(=O)C(C=[P+]([O-])CSc1ccc2ccccc2n1)(CC(C)C)OCC |
| InChI | InChI=1S/C21H28NO4PS/c1-5-25-20(23)21(26-6-2,13-16(3)4)14-27(24)15-28-19-12-11-17-9-7-8-10-18(17)22-19/h7-12,14,16H,5-6,13,15H2,1-4H3 |
| InChIKey | NKUIPZRBIKDMNC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|