C23H29O4PS — CID 140971645
(2-carboxy-3-cyclohexyl-2-ethoxypropylidene)-(naphthalen-2-ylsulfanylmethyl)-oxidophosphanium (PubChem CID 140971645) has the molecular formula C23H29O4PS and a molecular weight of 432.52 g/mol. Its IUPAC name is (2-carboxy-3-cyclohexyl-2-ethoxypropylidene)-(naphthalen-2-ylsulfanylmethyl)-oxidophosphanium.
| Compound Name | (2-carboxy-3-cyclohexyl-2-ethoxypropylidene)-(naphthalen-2-ylsulfanylmethyl)-oxidophosphanium |
|---|---|
| PubChem CID | 140971645 |
| Molecular Formula | C23H29O4PS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (2-carboxy-3-cyclohexyl-2-ethoxypropylidene)-(naphthalen-2-ylsulfanylmethyl)-oxidophosphanium |
| SMILES | CCOC(C=[P+]([O-])CSc1ccc2ccccc2c1)(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C23H29O4PS/c1-2-27-23(22(24)25,15-18-8-4-3-5-9-18)16-28(26)17-29-21-13-12-19-10-6-7-11-20(19)14-21/h6-7,10-14,16,18H,2-5,8-9,15,17H2,1H3,(H,24,25) |
| InChIKey | DJKOYKBSJVPUSS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|