C17H23O4PS — CID 140971609
(2-carboxy-3-cyclohexyl-2-hydroxypropylidene)-oxido-(phenylsulfanylmethyl)phosphanium (PubChem CID 140971609) has the molecular formula C17H23O4PS and a molecular weight of 354.41 g/mol. Its IUPAC name is (2-carboxy-3-cyclohexyl-2-hydroxypropylidene)-oxido-(phenylsulfanylmethyl)phosphanium.
| Compound Name | (2-carboxy-3-cyclohexyl-2-hydroxypropylidene)-oxido-(phenylsulfanylmethyl)phosphanium |
|---|---|
| PubChem CID | 140971609 |
| Molecular Formula | C17H23O4PS |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2-carboxy-3-cyclohexyl-2-hydroxypropylidene)-oxido-(phenylsulfanylmethyl)phosphanium |
| SMILES | O=C(O)C(O)(C=[P+]([O-])CSc1ccccc1)CC1CCCCC1 |
| InChI | InChI=1S/C17H23O4PS/c18-16(19)17(20,11-14-7-3-1-4-8-14)12-22(21)13-23-15-9-5-2-6-10-15/h2,5-6,9-10,12,14,20H,1,3-4,7-8,11,13H2,(H,18,19) |
| InChIKey | NOPUZFRUOLVVJZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|