C22H26O3S — CID 101440660
phenyl (2R,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanoate (PubChem CID 101440660) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is phenyl (2R,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanoate.
| Compound Name | phenyl (2R,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanoate |
|---|---|
| PubChem CID | 101440660 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | phenyl (2R,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanoate |
| SMILES | O=C(Oc1ccccc1)[C@H](CSc1ccccc1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C22H26O3S/c23-21(17-10-4-1-5-11-17)20(16-26-19-14-8-3-9-15-19)22(24)25-18-12-6-2-7-13-18/h2-3,6-9,12-15,17,20-21,23H,1,4-5,10-11,16H2/t20-,21-/m1/s1 |
| InChIKey | VMWKPRWONVCCTP-NHCUHLMSSA-N |
| XLogP | 4.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|