C15H21N3O2 — CID 174535676
phenyl 2-cyclohexyl-2-(diaminomethylideneamino)acetate (PubChem CID 174535676) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is phenyl 2-cyclohexyl-2-(diaminomethylideneamino)acetate.
| Compound Name | phenyl 2-cyclohexyl-2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 174535676 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | phenyl 2-cyclohexyl-2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NC(C(=O)Oc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O2/c16-15(17)18-13(11-7-3-1-4-8-11)14(19)20-12-9-5-2-6-10-12/h2,5-6,9-11,13H,1,3-4,7-8H2,(H4,16,17,18) |
| InChIKey | HSIQOSLJNFZKRZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|