C11H13N3O6 — CID 88685199
1-O-(diaminomethylideneamino) 4-O-phenyl 2,3-dihydroxybutanedioate (PubChem CID 88685199) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is 1-O-(diaminomethylideneamino) 4-O-phenyl 2,3-dihydroxybutanedioate.
| Compound Name | 1-O-(diaminomethylideneamino) 4-O-phenyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 88685199 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-O-(diaminomethylideneamino) 4-O-phenyl 2,3-dihydroxybutanedioate |
| SMILES | NC(N)=NOC(=O)C(O)C(O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H13N3O6/c12-11(13)14-20-10(18)8(16)7(15)9(17)19-6-4-2-1-3-5-6/h1-5,7-8,15-16H,(H4,12,13,14) |
| InChIKey | FAGHCQCJMIEFMH-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|