About 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate
2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate (PubChem CID 174866503) has the molecular formula C10H11N5O4
and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate.
Molecular Properties
| Compound Name | 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate |
| PubChem CID | 174866503 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate |
| SMILES | NC(N)=NC(N)=NOC(=O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H11N5O4/c11-9(12)14-10(13)15-19-8(17)7(16)18-6-4-2-1-3-5-6/h1-5H,(H6,11,12,13,14,15) |
| InChIKey | PHBIQSWRLNSKGO-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate?
The IUPAC name of 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate (CID 174866503) is 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate.
What is the SMILES notation for 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate?
The canonical SMILES for 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate is NC(N)=NC(N)=NOC(=O)C(=O)Oc1ccccc1.
What is the InChIKey of 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate?
The InChIKey is PHBIQSWRLNSKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O4/c11-9(12)14-10(13)15-19-8(17)7(16)18-6-4-2-1-3-5-6/h1-5H,(H6,11,12,13,14,15).
What are the key properties of 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate?
2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate has a molecular weight of 265.23 g/mol, XLogP of -1.36, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[[amino-(diaminomethylideneamino)methylidene]amino] 1-O-phenyl oxalate is sourced from PubChem (CID 174866503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).