C17H23O3PS — CID 174293187
3-cyclohexyl-2-methyl-4-phenylsulfanyl-2-phosphorosobutanoic acid (PubChem CID 174293187) has the molecular formula C17H23O3PS and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-cyclohexyl-2-methyl-4-phenylsulfanyl-2-phosphorosobutanoic acid.
| Compound Name | 3-cyclohexyl-2-methyl-4-phenylsulfanyl-2-phosphorosobutanoic acid |
|---|---|
| PubChem CID | 174293187 |
| Molecular Formula | C17H23O3PS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-cyclohexyl-2-methyl-4-phenylsulfanyl-2-phosphorosobutanoic acid |
| SMILES | CC(P=O)(C(=O)O)C(CSc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H23O3PS/c1-17(21-20,16(18)19)15(13-8-4-2-5-9-13)12-22-14-10-6-3-7-11-14/h3,6-7,10-11,13,15H,2,4-5,8-9,12H2,1H3,(H,18,19) |
| InChIKey | FZEUTOZANIRPIR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|