C20H29N3O2S — CID 47070919
1-cyclohexyl-3-[1-(2-phenylsulfanylacetyl)piperidin-4-yl]urea (PubChem CID 47070919) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2-phenylsulfanylacetyl)piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(2-phenylsulfanylacetyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 47070919 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2-phenylsulfanylacetyl)piperidin-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1CCN(C(=O)CSc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29N3O2S/c24-19(15-26-18-9-5-2-6-10-18)23-13-11-17(12-14-23)22-20(25)21-16-7-3-1-4-8-16/h2,5-6,9-10,16-17H,1,3-4,7-8,11-15H2,(H2,21,22,25) |
| InChIKey | TWTIJVQAYVRFSC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |